C7H6Cl2N2O2 — CID 58937974
methyl 4,6-dichloro-5-methylpyrimidine-2-carboxylate (PubChem CID 58937974) has the molecular formula C7H6Cl2N2O2 and a molecular weight of 221.04 g/mol. Its IUPAC name is methyl 4,6-dichloro-5-methylpyrimidine-2-carboxylate.
| Compound Name | methyl 4,6-dichloro-5-methylpyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 58937974 |
| Molecular Formula | C7H6Cl2N2O2 |
| Molecular Weight | 221.04 g/mol |
| Exact Mass | 219.98 |
| IUPAC Name | methyl 4,6-dichloro-5-methylpyrimidine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)c(C)c(Cl)n1 |
| InChI | InChI=1S/C7H6Cl2N2O2/c1-3-4(8)10-6(7(12)13-2)11-5(3)9/h1-2H3 |
| InChIKey | RLAOCZAYGLMZLA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.04 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |