C7H5N3O6 — CID 68537450
6-methoxycarbonyl-1,3,5-triazine-2,4-dicarboxylic acid (PubChem CID 68537450) has the molecular formula C7H5N3O6 and a molecular weight of 227.13 g/mol. Its IUPAC name is 6-methoxycarbonyl-1,3,5-triazine-2,4-dicarboxylic acid.
| Compound Name | 6-methoxycarbonyl-1,3,5-triazine-2,4-dicarboxylic acid |
|---|---|
| PubChem CID | 68537450 |
| Molecular Formula | C7H5N3O6 |
| Molecular Weight | 227.13 g/mol |
| Exact Mass | 227.02 |
| IUPAC Name | 6-methoxycarbonyl-1,3,5-triazine-2,4-dicarboxylic acid |
| SMILES | COC(=O)c1nc(C(=O)O)nc(C(=O)O)n1 |
| InChI | InChI=1S/C7H5N3O6/c1-16-7(15)4-9-2(5(11)12)8-3(10-4)6(13)14/h1H3,(H,11,12)(H,13,14) |
| InChIKey | MCTSBKAMWCPKQJ-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.13 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |