C10H11ClN2O2 — CID 84690746
methyl 6-chloro-2-cyclopropyl-5-methylpyrimidine-4-carboxylate (PubChem CID 84690746) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is methyl 6-chloro-2-cyclopropyl-5-methylpyrimidine-4-carboxylate.
| Compound Name | methyl 6-chloro-2-cyclopropyl-5-methylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 84690746 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | methyl 6-chloro-2-cyclopropyl-5-methylpyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C2CC2)nc(Cl)c1C |
| InChI | InChI=1S/C10H11ClN2O2/c1-5-7(10(14)15-2)12-9(6-3-4-6)13-8(5)11/h6H,3-4H2,1-2H3 |
| InChIKey | LVYYKMXCZHFKAA-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |