C10H11ClN2O2 — CID 174666918
3-amino-6-chloro-4-cyclopropyl-5-methylpyridine-2-carboxylic acid (PubChem CID 174666918) has the molecular formula C10H11ClN2O2 and a molecular weight of 226.66 g/mol. Its IUPAC name is 3-amino-6-chloro-4-cyclopropyl-5-methylpyridine-2-carboxylic acid.
| Compound Name | 3-amino-6-chloro-4-cyclopropyl-5-methylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 174666918 |
| Molecular Formula | C10H11ClN2O2 |
| Molecular Weight | 226.66 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 3-amino-6-chloro-4-cyclopropyl-5-methylpyridine-2-carboxylic acid |
| SMILES | Cc1c(Cl)nc(C(=O)O)c(N)c1C1CC1 |
| InChI | InChI=1S/C10H11ClN2O2/c1-4-6(5-2-3-5)7(12)8(10(14)15)13-9(4)11/h5H,2-3,12H2,1H3,(H,14,15) |
| InChIKey | QEUQXBQUYAPCNF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.66 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|