C11H13ClN4O2 — CID 146293243
(propan-2-ylideneamino) 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate (PubChem CID 146293243) has the molecular formula C11H13ClN4O2 and a molecular weight of 268.70 g/mol. Its IUPAC name is (propan-2-ylideneamino) 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate.
| Compound Name | (propan-2-ylideneamino) 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 146293243 |
| Molecular Formula | C11H13ClN4O2 |
| Molecular Weight | 268.70 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | (propan-2-ylideneamino) 6-amino-5-chloro-2-cyclopropylpyrimidine-4-carboxylate |
| SMILES | CC(C)=NOC(=O)c1nc(C2CC2)nc(N)c1Cl |
| InChI | InChI=1S/C11H13ClN4O2/c1-5(2)16-18-11(17)8-7(12)9(13)15-10(14-8)6-3-4-6/h6H,3-4H2,1-2H3,(H2,13,14,15) |
| InChIKey | GMDMGQQBTUPUGF-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.70 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|