C15H15ClN4O2 — CID 67094450
methyl 5-chloro-2-cyclopropyl-6-[methyl(pyridin-4-yl)amino]pyrimidine-4-carboxylate (PubChem CID 67094450) has the molecular formula C15H15ClN4O2 and a molecular weight of 318.76 g/mol. Its IUPAC name is methyl 5-chloro-2-cyclopropyl-6-[methyl(pyridin-4-yl)amino]pyrimidine-4-carboxylate.
| Compound Name | methyl 5-chloro-2-cyclopropyl-6-[methyl(pyridin-4-yl)amino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 67094450 |
| Molecular Formula | C15H15ClN4O2 |
| Molecular Weight | 318.76 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | methyl 5-chloro-2-cyclopropyl-6-[methyl(pyridin-4-yl)amino]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C2CC2)nc(N(C)c2ccncc2)c1Cl |
| InChI | InChI=1S/C15H15ClN4O2/c1-20(10-5-7-17-8-6-10)14-11(16)12(15(21)22-2)18-13(19-14)9-3-4-9/h5-9H,3-4H2,1-2H3 |
| InChIKey | FJTNTIHOJRINOF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 68.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.76 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |