C17H17ClN4O4 — CID 58220576
methyl 5-chloro-2-cyclopropyl-6-[methyl-[(2-nitrophenyl)methyl]amino]pyrimidine-4-carboxylate (PubChem CID 58220576) has the molecular formula C17H17ClN4O4 and a molecular weight of 376.80 g/mol. Its IUPAC name is methyl 5-chloro-2-cyclopropyl-6-[methyl-[(2-nitrophenyl)methyl]amino]pyrimidine-4-carboxylate.
| Compound Name | methyl 5-chloro-2-cyclopropyl-6-[methyl-[(2-nitrophenyl)methyl]amino]pyrimidine-4-carboxylate |
|---|---|
| PubChem CID | 58220576 |
| Molecular Formula | C17H17ClN4O4 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | methyl 5-chloro-2-cyclopropyl-6-[methyl-[(2-nitrophenyl)methyl]amino]pyrimidine-4-carboxylate |
| SMILES | COC(=O)c1nc(C2CC2)nc(N(C)Cc2ccccc2[N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C17H17ClN4O4/c1-21(9-11-5-3-4-6-12(11)22(24)25)16-13(18)14(17(23)26-2)19-15(20-16)10-7-8-10/h3-6,10H,7-9H2,1-2H3 |
| InChIKey | GKRKEERVNUNIJZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 98.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|