C16H20N2O3 — CID 129376999
(1S,2R,4S)-N-methyl-N-[(2-nitrophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 129376999) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is (1S,2R,4S)-N-methyl-N-[(2-nitrophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1S,2R,4S)-N-methyl-N-[(2-nitrophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 129376999 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | (1S,2R,4S)-N-methyl-N-[(2-nitrophenyl)methyl]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | CN(Cc1ccccc1[N+](=O)[O-])C(=O)[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C16H20N2O3/c1-17(10-13-4-2-3-5-15(13)18(20)21)16(19)14-9-11-6-7-12(14)8-11/h2-5,11-12,14H,6-10H2,1H3/t11-,12-,14+/m0/s1 |
| InChIKey | IMGCCBAFZSDNIX-SGMGOOAPSA-N |
| XLogP | 2.99 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|