C8H8Cl2N2O — CID 46941488
(4,6-dichloro-2-cyclopropylpyrimidin-5-yl)methanol (PubChem CID 46941488) has the molecular formula C8H8Cl2N2O and a molecular weight of 219.07 g/mol. Its IUPAC name is (4,6-dichloro-2-cyclopropylpyrimidin-5-yl)methanol.
| Compound Name | (4,6-dichloro-2-cyclopropylpyrimidin-5-yl)methanol |
|---|---|
| PubChem CID | 46941488 |
| Molecular Formula | C8H8Cl2N2O |
| Molecular Weight | 219.07 g/mol |
| Exact Mass | 218.00 |
| IUPAC Name | (4,6-dichloro-2-cyclopropylpyrimidin-5-yl)methanol |
| SMILES | OCc1c(Cl)nc(C2CC2)nc1Cl |
| InChI | InChI=1S/C8H8Cl2N2O/c9-6-5(3-13)7(10)12-8(11-6)4-1-2-4/h4,13H,1-3H2 |
| InChIKey | XVMOVSKQAQZKQT-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.07 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |