C10H4BrCl2F2N — CID 170448621
6-bromo-3,4-dichloro-5,7-difluoro-2-methylquinoline (PubChem CID 170448621) has the molecular formula C10H4BrCl2F2N and a molecular weight of 326.96 g/mol. Its IUPAC name is 6-bromo-3,4-dichloro-5,7-difluoro-2-methylquinoline.
| Compound Name | 6-bromo-3,4-dichloro-5,7-difluoro-2-methylquinoline |
|---|---|
| PubChem CID | 170448621 |
| Molecular Formula | C10H4BrCl2F2N |
| Molecular Weight | 326.96 g/mol |
| Exact Mass | 324.89 |
| IUPAC Name | 6-bromo-3,4-dichloro-5,7-difluoro-2-methylquinoline |
| SMILES | Cc1nc2cc(F)c(Br)c(F)c2c(Cl)c1Cl |
| InChI | InChI=1S/C10H4BrCl2F2N/c1-3-8(12)9(13)6-5(16-3)2-4(14)7(11)10(6)15/h2H,1H3 |
| InChIKey | NGYIVTHZWAJLQF-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.96 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|