About 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride
3-bromo-2,4-difluoro-6-methylaniline;hydrochloride (PubChem CID 178161006) has the molecular formula C7H7BrClF2N
and a molecular weight of 258.49 g/mol. Its IUPAC name is 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride.
Molecular Properties
| Compound Name | 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride |
| PubChem CID | 178161006 |
| Molecular Formula | C7H7BrClF2N |
| Molecular Weight | 258.49 g/mol |
| Exact Mass | 256.94 |
| IUPAC Name | 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride |
| SMILES | Cc1cc(F)c(Br)c(F)c1N.Cl |
| InChI | InChI=1S/C7H6BrF2N.ClH/c1-3-2-4(9)5(8)6(10)7(3)11;/h2H,11H2,1H3;1H |
| InChIKey | GTLBAWPIZBJGNI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride?
The IUPAC name of 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride (CID 178161006) is 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride.
What is the SMILES notation for 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride?
The canonical SMILES for 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride is Cc1cc(F)c(Br)c(F)c1N.Cl.
What is the InChIKey of 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride?
The InChIKey is GTLBAWPIZBJGNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF2N.ClH/c1-3-2-4(9)5(8)6(10)7(3)11;/h2H,11H2,1H3;1H.
What are the key properties of 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride?
3-bromo-2,4-difluoro-6-methylaniline;hydrochloride has a molecular weight of 258.49 g/mol, XLogP of 3.04, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4-difluoro-6-methylaniline;hydrochloride is sourced from PubChem (CID 178161006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).