About 3-bromo-2,4,6-trifluoro-5-methylaniline
3-bromo-2,4,6-trifluoro-5-methylaniline (PubChem CID 77134473) has the molecular formula C7H5BrF3N
and a molecular weight of 240.02 g/mol. Its IUPAC name is 3-bromo-2,4,6-trifluoro-5-methylaniline.
Molecular Properties
| Compound Name | 3-bromo-2,4,6-trifluoro-5-methylaniline |
| PubChem CID | 77134473 |
| Molecular Formula | C7H5BrF3N |
| Molecular Weight | 240.02 g/mol |
| Exact Mass | 238.96 |
| IUPAC Name | 3-bromo-2,4,6-trifluoro-5-methylaniline |
| SMILES | Cc1c(F)c(N)c(F)c(Br)c1F |
| InChI | InChI=1S/C7H5BrF3N/c1-2-4(9)3(8)6(11)7(12)5(2)10/h12H2,1H3 |
| InChIKey | WITJOYKDRXXMCL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.02 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-2,4,6-trifluoro-5-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2,4,6-trifluoro-5-methylaniline?
The IUPAC name of 3-bromo-2,4,6-trifluoro-5-methylaniline (CID 77134473) is 3-bromo-2,4,6-trifluoro-5-methylaniline.
What is the SMILES notation for 3-bromo-2,4,6-trifluoro-5-methylaniline?
The canonical SMILES for 3-bromo-2,4,6-trifluoro-5-methylaniline is Cc1c(F)c(N)c(F)c(Br)c1F.
What is the InChIKey of 3-bromo-2,4,6-trifluoro-5-methylaniline?
The InChIKey is WITJOYKDRXXMCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrF3N/c1-2-4(9)3(8)6(11)7(12)5(2)10/h12H2,1H3.
What are the key properties of 3-bromo-2,4,6-trifluoro-5-methylaniline?
3-bromo-2,4,6-trifluoro-5-methylaniline has a molecular weight of 240.02 g/mol, XLogP of 2.76, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2,4,6-trifluoro-5-methylaniline is sourced from PubChem (CID 77134473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).