C7H4BrF3N2O — CID 164875926
2-amino-4-bromo-3,5,6-trifluorobenzamide (PubChem CID 164875926) has the molecular formula C7H4BrF3N2O and a molecular weight of 269.02 g/mol. Its IUPAC name is 2-amino-4-bromo-3,5,6-trifluorobenzamide.
| Compound Name | 2-amino-4-bromo-3,5,6-trifluorobenzamide |
|---|---|
| PubChem CID | 164875926 |
| Molecular Formula | C7H4BrF3N2O |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 2-amino-4-bromo-3,5,6-trifluorobenzamide |
| SMILES | NC(=O)c1c(N)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C7H4BrF3N2O/c8-2-4(10)3(9)1(7(13)14)6(12)5(2)11/h12H2,(H2,13,14) |
| InChIKey | WMFZBILFPXUBFN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|