About 2-amino-4-bromo-3,5,6-trifluorobenzamide
2-amino-4-bromo-3,5,6-trifluorobenzamide (PubChem CID 164875926) has the molecular formula C7H4BrF3N2O
and a molecular weight of 269.02 g/mol. Its IUPAC name is 2-amino-4-bromo-3,5,6-trifluorobenzamide.
Molecular Properties
| Compound Name | 2-amino-4-bromo-3,5,6-trifluorobenzamide |
| PubChem CID | 164875926 |
| Molecular Formula | C7H4BrF3N2O |
| Molecular Weight | 269.02 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 2-amino-4-bromo-3,5,6-trifluorobenzamide |
| SMILES | NC(=O)c1c(N)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C7H4BrF3N2O/c8-2-4(10)3(9)1(7(13)14)6(12)5(2)11/h12H2,(H2,13,14) |
| InChIKey | WMFZBILFPXUBFN-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.02 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-bromo-3,5,6-trifluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-bromo-3,5,6-trifluorobenzamide?
The IUPAC name of 2-amino-4-bromo-3,5,6-trifluorobenzamide (CID 164875926) is 2-amino-4-bromo-3,5,6-trifluorobenzamide.
What is the SMILES notation for 2-amino-4-bromo-3,5,6-trifluorobenzamide?
The canonical SMILES for 2-amino-4-bromo-3,5,6-trifluorobenzamide is NC(=O)c1c(N)c(F)c(Br)c(F)c1F.
What is the InChIKey of 2-amino-4-bromo-3,5,6-trifluorobenzamide?
The InChIKey is WMFZBILFPXUBFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrF3N2O/c8-2-4(10)3(9)1(7(13)14)6(12)5(2)11/h12H2,(H2,13,14).
What are the key properties of 2-amino-4-bromo-3,5,6-trifluorobenzamide?
2-amino-4-bromo-3,5,6-trifluorobenzamide has a molecular weight of 269.02 g/mol, XLogP of 1.55, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-bromo-3,5,6-trifluorobenzamide is sourced from PubChem (CID 164875926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).