C14H2F11NO2 — CID 101118820
2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzamide (PubChem CID 101118820) has the molecular formula C14H2F11NO2 and a molecular weight of 425.15 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzamide |
|---|---|
| PubChem CID | 101118820 |
| Molecular Formula | C14H2F11NO2 |
| Molecular Weight | 425.15 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenoxy]benzamide |
| SMILES | NC(=O)c1c(F)c(F)c(Oc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C14H2F11NO2/c15-3-1(13(26)27)4(16)8(20)11(7(3)19)28-12-9(21)5(17)2(14(23,24)25)6(18)10(12)22/h(H2,26,27) |
| InChIKey | KCOLHKVWMPRQDZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.15 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|