C9H5F6NO2 — CID 118997009
3-hydroxy-2,6-bis(trifluoromethyl)benzamide (PubChem CID 118997009) has the molecular formula C9H5F6NO2 and a molecular weight of 273.13 g/mol. Its IUPAC name is 3-hydroxy-2,6-bis(trifluoromethyl)benzamide.
| Compound Name | 3-hydroxy-2,6-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118997009 |
| Molecular Formula | C9H5F6NO2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 3-hydroxy-2,6-bis(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1c(C(F)(F)F)ccc(O)c1C(F)(F)F |
| InChI | InChI=1S/C9H5F6NO2/c10-8(11,12)3-1-2-4(17)6(9(13,14)15)5(3)7(16)18/h1-2,17H,(H2,16,18) |
| InChIKey | ILYRHGTWWXFKCA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |