C9H3ClF6O2 — CID 134639153
2-hydroxy-3,6-bis(trifluoromethyl)benzoyl chloride (PubChem CID 134639153) has the molecular formula C9H3ClF6O2 and a molecular weight of 292.56 g/mol. Its IUPAC name is 2-hydroxy-3,6-bis(trifluoromethyl)benzoyl chloride.
| Compound Name | 2-hydroxy-3,6-bis(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 134639153 |
| Molecular Formula | C9H3ClF6O2 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 291.97 |
| IUPAC Name | 2-hydroxy-3,6-bis(trifluoromethyl)benzoyl chloride |
| SMILES | O=C(Cl)c1c(C(F)(F)F)ccc(C(F)(F)F)c1O |
| InChI | InChI=1S/C9H3ClF6O2/c10-7(18)5-3(8(11,12)13)1-2-4(6(5)17)9(14,15)16/h1-2,17H |
| InChIKey | AZDPQZAWJDMFNU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|