C11H6F6O3 — CID 119000940
(E)-3-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 119000940) has the molecular formula C11H6F6O3 and a molecular weight of 300.15 g/mol. Its IUPAC name is (E)-3-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 119000940 |
| Molecular Formula | C11H6F6O3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (E)-3-[6-hydroxy-2,3-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(O)ccc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C11H6F6O3/c12-10(13,14)6-2-3-7(18)5(1-4-8(19)20)9(6)11(15,16)17/h1-4,18H,(H,19,20)/b4-1+ |
| InChIKey | QUISGGLTHCPVKM-DAFODLJHSA-N |
| XLogP | 3.53 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|