C10H7F3O3 — CID 134650042
(E)-3-[2-hydroxy-6-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 134650042) has the molecular formula C10H7F3O3 and a molecular weight of 232.16 g/mol. Its IUPAC name is (E)-3-[2-hydroxy-6-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-hydroxy-6-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134650042 |
| Molecular Formula | C10H7F3O3 |
| Molecular Weight | 232.16 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | (E)-3-[2-hydroxy-6-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(O)cccc1C(F)(F)F |
| InChI | InChI=1S/C10H7F3O3/c11-10(12,13)7-2-1-3-8(14)6(7)4-5-9(15)16/h1-5,14H,(H,15,16)/b5-4+ |
| InChIKey | BMSCFJRZIZWERJ-SNAWJCMRSA-N |
| XLogP | 2.51 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|