C11H5F6IO2 — CID 119003651
(E)-3-[4-iodo-2,6-bis(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 119003651) has the molecular formula C11H5F6IO2 and a molecular weight of 410.05 g/mol. Its IUPAC name is (E)-3-[4-iodo-2,6-bis(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-iodo-2,6-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 119003651 |
| Molecular Formula | C11H5F6IO2 |
| Molecular Weight | 410.05 g/mol |
| Exact Mass | 409.92 |
| IUPAC Name | (E)-3-[4-iodo-2,6-bis(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1c(C(F)(F)F)cc(I)cc1C(F)(F)F |
| InChI | InChI=1S/C11H5F6IO2/c12-10(13,14)7-3-5(18)4-8(11(15,16)17)6(7)1-2-9(19)20/h1-4H,(H,19,20)/b2-1+ |
| InChIKey | FPFUCJBOCBBZRO-OWOJBTEDSA-N |
| XLogP | 4.43 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.05 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|