C13H10BrF3O3 — CID 170837348
3-[2-(1-bromo-2-oxopropyl)-6-(trifluoromethyl)phenyl]prop-2-enoic acid (PubChem CID 170837348) has the molecular formula C13H10BrF3O3 and a molecular weight of 351.12 g/mol. Its IUPAC name is 3-[2-(1-bromo-2-oxopropyl)-6-(trifluoromethyl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[2-(1-bromo-2-oxopropyl)-6-(trifluoromethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170837348 |
| Molecular Formula | C13H10BrF3O3 |
| Molecular Weight | 351.12 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 3-[2-(1-bromo-2-oxopropyl)-6-(trifluoromethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(=O)C(Br)c1cccc(C(F)(F)F)c1C=CC(=O)O |
| InChI | InChI=1S/C13H10BrF3O3/c1-7(18)12(14)9-3-2-4-10(13(15,16)17)8(9)5-6-11(19)20/h2-6,12H,1H3,(H,19,20) |
| InChIKey | MIOULRCFHRYFCR-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.12 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|