C14H12BrNO3 — CID 134650079
(E)-3-[3-(1-bromo-2-oxopropyl)-2-(cyanomethyl)phenyl]prop-2-enoic acid (PubChem CID 134650079) has the molecular formula C14H12BrNO3 and a molecular weight of 322.16 g/mol. Its IUPAC name is (E)-3-[3-(1-bromo-2-oxopropyl)-2-(cyanomethyl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-(1-bromo-2-oxopropyl)-2-(cyanomethyl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 134650079 |
| Molecular Formula | C14H12BrNO3 |
| Molecular Weight | 322.16 g/mol |
| Exact Mass | 321.00 |
| IUPAC Name | (E)-3-[3-(1-bromo-2-oxopropyl)-2-(cyanomethyl)phenyl]prop-2-enoic acid |
| SMILES | CC(=O)C(Br)c1cccc(/C=C/C(=O)O)c1CC#N |
| InChI | InChI=1S/C14H12BrNO3/c1-9(17)14(15)12-4-2-3-10(5-6-13(18)19)11(12)7-8-16/h2-6,14H,7H2,1H3,(H,18,19)/b6-5+ |
| InChIKey | DKTLIPVEKHBIDZ-AATRIKPKSA-N |
| XLogP | 2.88 |
| TPSA | 78.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.16 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|