C12H11BrO4 — CID 170837352
2-[2-(1-bromo-2-oxopropyl)-6-formylphenyl]acetic acid (PubChem CID 170837352) has the molecular formula C12H11BrO4 and a molecular weight of 299.12 g/mol. Its IUPAC name is 2-[2-(1-bromo-2-oxopropyl)-6-formylphenyl]acetic acid.
| Compound Name | 2-[2-(1-bromo-2-oxopropyl)-6-formylphenyl]acetic acid |
|---|---|
| PubChem CID | 170837352 |
| Molecular Formula | C12H11BrO4 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 2-[2-(1-bromo-2-oxopropyl)-6-formylphenyl]acetic acid |
| SMILES | CC(=O)C(Br)c1cccc(C=O)c1CC(=O)O |
| InChI | InChI=1S/C12H11BrO4/c1-7(15)12(13)9-4-2-3-8(6-14)10(9)5-11(16)17/h2-4,6,12H,5H2,1H3,(H,16,17) |
| InChIKey | AFIZTTDWLKUFHJ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|