C10H5F6NO2 — CID 133095214
(E)-3-[3,6-bis(trifluoromethyl)-2-pyridinyl]prop-2-enoic acid (PubChem CID 133095214) has the molecular formula C10H5F6NO2 and a molecular weight of 285.14 g/mol. Its IUPAC name is (E)-3-[3,6-bis(trifluoromethyl)-2-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3,6-bis(trifluoromethyl)-2-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 133095214 |
| Molecular Formula | C10H5F6NO2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | (E)-3-[3,6-bis(trifluoromethyl)-2-pyridinyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1nc(C(F)(F)F)ccc1C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO2/c11-9(12,13)5-1-3-7(10(14,15)16)17-6(5)2-4-8(18)19/h1-4H,(H,18,19)/b4-2+ |
| InChIKey | HYGPAHQQHRLLRD-DUXPYHPUSA-N |
| XLogP | 3.22 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|