C13H15F3N2O2 — CID 68785746
(E)-3-[2-[methyl(propyl)amino]-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid (PubChem CID 68785746) has the molecular formula C13H15F3N2O2 and a molecular weight of 288.27 g/mol. Its IUPAC name is (E)-3-[2-[methyl(propyl)amino]-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[methyl(propyl)amino]-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68785746 |
| Molecular Formula | C13H15F3N2O2 |
| Molecular Weight | 288.27 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (E)-3-[2-[methyl(propyl)amino]-6-(trifluoromethyl)-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCCN(C)c1nc(C(F)(F)F)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C13H15F3N2O2/c1-3-8-18(2)12-9(5-7-11(19)20)4-6-10(17-12)13(14,15)16/h4-7H,3,8H2,1-2H3,(H,19,20)/b7-5+ |
| InChIKey | HUKMDEJMCSIGPU-FNORWQNLSA-N |
| XLogP | 3.04 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|