C10H6F6N2O4 — CID 174306920
2,4-bis(trifluoromethyl)pyrimidine;(Z)-but-2-enedioic acid (PubChem CID 174306920) has the molecular formula C10H6F6N2O4 and a molecular weight of 332.16 g/mol. Its IUPAC name is 2,4-bis(trifluoromethyl)pyrimidine;(Z)-but-2-enedioic acid.
| Compound Name | 2,4-bis(trifluoromethyl)pyrimidine;(Z)-but-2-enedioic acid |
|---|---|
| PubChem CID | 174306920 |
| Molecular Formula | C10H6F6N2O4 |
| Molecular Weight | 332.16 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2,4-bis(trifluoromethyl)pyrimidine;(Z)-but-2-enedioic acid |
| SMILES | FC(F)(F)c1ccnc(C(F)(F)F)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C6H2F6N2.C4H4O4/c7-5(8,9)3-1-2-13-4(14-3)6(10,11)12;5-3(6)1-2-4(7)8/h1-2H;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | VOUXWTOBVKIIPK-BTJKTKAUSA-N |
| XLogP | 2.23 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.16 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|