C6H2F3LiN2O2 — CID 146155155
lithium 4-(trifluoromethyl)pyrimidine-2-carboxylate (PubChem CID 146155155) has the molecular formula C6H2F3LiN2O2 and a molecular weight of 198.03 g/mol. Its IUPAC name is lithium 4-(trifluoromethyl)pyrimidine-2-carboxylate.
| Compound Name | lithium 4-(trifluoromethyl)pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 146155155 |
| Molecular Formula | C6H2F3LiN2O2 |
| Molecular Weight | 198.03 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | lithium 4-(trifluoromethyl)pyrimidine-2-carboxylate |
| SMILES | O=C([O-])c1nccc(C(F)(F)F)n1.[Li+] |
| InChI | InChI=1S/C6H3F3N2O2.Li/c7-6(8,9)3-1-2-10-4(11-3)5(12)13;/h1-2H,(H,12,13);/q;+1/p-1 |
| InChIKey | ROLRHDRBAGFUMG-UHFFFAOYSA-M |
| XLogP | -3.14 |
| TPSA | 65.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.03 |
| LogP ≤ 5 | -3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |