C17H4F8O8 — CID 23304024
4-[(3,4-dicarboxy-2,5,6-trifluorophenyl)-difluoromethyl]-3,5,6-trifluorophthalic acid (PubChem CID 23304024) has the molecular formula C17H4F8O8 and a molecular weight of 488.20 g/mol. Its IUPAC name is 4-[(3,4-dicarboxy-2,5,6-trifluorophenyl)-difluoromethyl]-3,5,6-trifluorophthalic acid.
| Compound Name | 4-[(3,4-dicarboxy-2,5,6-trifluorophenyl)-difluoromethyl]-3,5,6-trifluorophthalic acid |
|---|---|
| PubChem CID | 23304024 |
| Molecular Formula | C17H4F8O8 |
| Molecular Weight | 488.20 g/mol |
| Exact Mass | 487.98 |
| IUPAC Name | 4-[(3,4-dicarboxy-2,5,6-trifluorophenyl)-difluoromethyl]-3,5,6-trifluorophthalic acid |
| SMILES | O=C(O)c1c(F)c(F)c(C(F)(F)c2c(F)c(F)c(C(=O)O)c(C(=O)O)c2F)c(F)c1C(=O)O |
| InChI | InChI=1S/C17H4F8O8/c18-7-1(13(26)27)3(15(30)31)9(20)11(22)5(7)17(24,25)6-8(19)2(14(28)29)4(16(32)33)10(21)12(6)23/h(H,26,27)(H,28,29)(H,30,31)(H,32,33) |
| InChIKey | MSUZRGKCMBYFNY-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|