C20H18F8O — CID 122472031
1-tert-butyl-4-(4-tert-butyl-2,3,5,6-tetrafluorophenoxy)-2,3,5,6-tetrafluorobenzene (PubChem CID 122472031) has the molecular formula C20H18F8O and a molecular weight of 426.35 g/mol. Its IUPAC name is 1-tert-butyl-4-(4-tert-butyl-2,3,5,6-tetrafluorophenoxy)-2,3,5,6-tetrafluorobenzene.
| Compound Name | 1-tert-butyl-4-(4-tert-butyl-2,3,5,6-tetrafluorophenoxy)-2,3,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 122472031 |
| Molecular Formula | C20H18F8O |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 1-tert-butyl-4-(4-tert-butyl-2,3,5,6-tetrafluorophenoxy)-2,3,5,6-tetrafluorobenzene |
| SMILES | CC(C)(C)c1c(F)c(F)c(Oc2c(F)c(F)c(C(C)(C)C)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C20H18F8O/c1-19(2,3)7-9(21)13(25)17(14(26)10(7)22)29-18-15(27)11(23)8(20(4,5)6)12(24)16(18)28/h1-6H3 |
| InChIKey | CXRXFQZIRUOVHM-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|