C10H10F4S — CID 144813855
4-tert-butyl-2,3,5,6-tetrafluorobenzenethiol (PubChem CID 144813855) has the molecular formula C10H10F4S and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-tert-butyl-2,3,5,6-tetrafluorobenzenethiol.
| Compound Name | 4-tert-butyl-2,3,5,6-tetrafluorobenzenethiol |
|---|---|
| PubChem CID | 144813855 |
| Molecular Formula | C10H10F4S |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 4-tert-butyl-2,3,5,6-tetrafluorobenzenethiol |
| SMILES | CC(C)(C)c1c(F)c(F)c(S)c(F)c1F |
| InChI | InChI=1S/C10H10F4S/c1-10(2,3)4-5(11)7(13)9(15)8(14)6(4)12/h15H,1-3H3 |
| InChIKey | VTMYNJYDMJMZSM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|