C11H15F5S — CID 142404635
ethane;2,3,4,5,6-pentafluorobenzenethiol;propane (PubChem CID 142404635) has the molecular formula C11H15F5S and a molecular weight of 274.30 g/mol. Its IUPAC name is ethane;2,3,4,5,6-pentafluorobenzenethiol;propane.
| Compound Name | ethane;2,3,4,5,6-pentafluorobenzenethiol;propane |
|---|---|
| PubChem CID | 142404635 |
| Molecular Formula | C11H15F5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | ethane;2,3,4,5,6-pentafluorobenzenethiol;propane |
| SMILES | CC.CCC.Fc1c(F)c(F)c(S)c(F)c1F |
| InChI | InChI=1S/C6HF5S.C3H8.C2H6/c7-1-2(8)4(10)6(12)5(11)3(1)9;1-3-2;1-2/h12H;3H2,1-2H3;1-2H3 |
| InChIKey | NNXHLDNBDIFVPO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|