C22HF15S2 — CID 177164216
2,3,5,6-tetrafluoro-4-[2,3,5,6,7,8-hexafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylnaphthalen-1-yl]benzenethiol (PubChem CID 177164216) has the molecular formula C22HF15S2 and a molecular weight of 614.35 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-[2,3,5,6,7,8-hexafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylnaphthalen-1-yl]benzenethiol.
| Compound Name | 2,3,5,6-tetrafluoro-4-[2,3,5,6,7,8-hexafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylnaphthalen-1-yl]benzenethiol |
|---|---|
| PubChem CID | 177164216 |
| Molecular Formula | C22HF15S2 |
| Molecular Weight | 614.35 g/mol |
| Exact Mass | 613.93 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-[2,3,5,6,7,8-hexafluoro-4-(2,3,4,5,6-pentafluorophenyl)sulfanylnaphthalen-1-yl]benzenethiol |
| SMILES | Fc1c(F)c(F)c(Sc2c(F)c(F)c(-c3c(F)c(F)c(S)c(F)c3F)c3c(F)c(F)c(F)c(F)c23)c(F)c1F |
| InChI | InChI=1S/C22HF15S2/c23-5-2-1(3-7(25)15(33)20(38)16(34)8(3)26)6(24)17(35)21(4(2)9(27)11(29)10(5)28)39-22-18(36)13(31)12(30)14(32)19(22)37/h38H |
| InChIKey | UOOHDIMBPUFONT-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.35 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|