C13H4F8S — CID 144962072
2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzenethiol (PubChem CID 144962072) has the molecular formula C13H4F8S and a molecular weight of 344.23 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzenethiol.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzenethiol |
|---|---|
| PubChem CID | 144962072 |
| Molecular Formula | C13H4F8S |
| Molecular Weight | 344.23 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-methylphenyl)benzenethiol |
| SMILES | Cc1c(F)c(F)c(-c2c(F)c(F)c(S)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C13H4F8S/c1-2-5(14)7(16)3(8(17)6(2)15)4-9(18)11(20)13(22)12(21)10(4)19/h22H,1H3 |
| InChIKey | GIQWVRGEJVKFKY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.23 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|