C13H3F6I3 — CID 146603757
1,2-difluoro-3,4,6-triiodo-5-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene (PubChem CID 146603757) has the molecular formula C13H3F6I3 and a molecular weight of 653.87 g/mol. Its IUPAC name is 1,2-difluoro-3,4,6-triiodo-5-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene.
| Compound Name | 1,2-difluoro-3,4,6-triiodo-5-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene |
|---|---|
| PubChem CID | 146603757 |
| Molecular Formula | C13H3F6I3 |
| Molecular Weight | 653.87 g/mol |
| Exact Mass | 653.73 |
| IUPAC Name | 1,2-difluoro-3,4,6-triiodo-5-(2,3,5,6-tetrafluoro-4-methylphenyl)benzene |
| SMILES | Cc1c(F)c(F)c(-c2c(I)c(F)c(F)c(I)c2I)c(F)c1F |
| InChI | InChI=1S/C13H3F6I3/c1-2-5(14)7(16)3(8(17)6(2)15)4-11(20)9(18)10(19)13(22)12(4)21/h1H3 |
| InChIKey | XMUQZMVXOUUQPH-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.87 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|