C12H2F8IN — CID 130427136
2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-iodophenyl)aniline (PubChem CID 130427136) has the molecular formula C12H2F8IN and a molecular weight of 439.04 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-iodophenyl)aniline.
| Compound Name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-iodophenyl)aniline |
|---|---|
| PubChem CID | 130427136 |
| Molecular Formula | C12H2F8IN |
| Molecular Weight | 439.04 g/mol |
| Exact Mass | 438.91 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-(2,3,5,6-tetrafluoro-4-iodophenyl)aniline |
| SMILES | Nc1c(F)c(F)c(-c2c(F)c(F)c(I)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C12H2F8IN/c13-3-1(4(14)8(18)11(21)7(3)17)2-5(15)9(19)12(22)10(20)6(2)16/h22H2 |
| InChIKey | LXEPZBGVRYHJCQ-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.04 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|