C15H13F5N2 — CID 118066890
4-(4-amino-2,3,6-trifluoro-5-methylphenyl)-3,5-difluoro-2,6-dimethylaniline (PubChem CID 118066890) has the molecular formula C15H13F5N2 and a molecular weight of 316.27 g/mol. Its IUPAC name is 4-(4-amino-2,3,6-trifluoro-5-methylphenyl)-3,5-difluoro-2,6-dimethylaniline.
| Compound Name | 4-(4-amino-2,3,6-trifluoro-5-methylphenyl)-3,5-difluoro-2,6-dimethylaniline |
|---|---|
| PubChem CID | 118066890 |
| Molecular Formula | C15H13F5N2 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 4-(4-amino-2,3,6-trifluoro-5-methylphenyl)-3,5-difluoro-2,6-dimethylaniline |
| SMILES | Cc1c(N)c(C)c(F)c(-c2c(F)c(C)c(N)c(F)c2F)c1F |
| InChI | InChI=1S/C15H13F5N2/c1-4-9(16)7(10(17)5(2)14(4)21)8-11(18)6(3)15(22)13(20)12(8)19/h21-22H2,1-3H3 |
| InChIKey | HBGXSTWULJIBHA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|