C11H18ClN — CID 139747221
2,3,4,5,6-pentamethylaniline;hydrochloride (PubChem CID 139747221) has the molecular formula C11H18ClN and a molecular weight of 199.72 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethylaniline;hydrochloride.
| Compound Name | 2,3,4,5,6-pentamethylaniline;hydrochloride |
|---|---|
| PubChem CID | 139747221 |
| Molecular Formula | C11H18ClN |
| Molecular Weight | 199.72 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 2,3,4,5,6-pentamethylaniline;hydrochloride |
| SMILES | Cc1c(C)c(C)c(N)c(C)c1C.Cl |
| InChI | InChI=1S/C11H17N.ClH/c1-6-7(2)9(4)11(12)10(5)8(6)3;/h12H2,1-5H3;1H |
| InChIKey | HXZMUVROQCCIMW-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.72 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|