C16H22N2O — CID 175596524
4-(4-aminophenyl)-2,3,5,6-tetramethylaniline;hydrate (PubChem CID 175596524) has the molecular formula C16H22N2O and a molecular weight of 258.37 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3,5,6-tetramethylaniline;hydrate.
| Compound Name | 4-(4-aminophenyl)-2,3,5,6-tetramethylaniline;hydrate |
|---|---|
| PubChem CID | 175596524 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | 4-(4-aminophenyl)-2,3,5,6-tetramethylaniline;hydrate |
| SMILES | Cc1c(C)c(-c2ccc(N)cc2)c(C)c(C)c1N.O |
| InChI | InChI=1S/C16H20N2.H2O/c1-9-11(3)16(18)12(4)10(2)15(9)13-5-7-14(17)8-6-13;/h5-8H,17-18H2,1-4H3;1H2 |
| InChIKey | MAQVKALTTUPJOC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|