C40H36N2 — CID 87615494
4-(4-aminophenyl)-2,3,5,6-tetrakis(3-methylphenyl)aniline (PubChem CID 87615494) has the molecular formula C40H36N2 and a molecular weight of 544.74 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3,5,6-tetrakis(3-methylphenyl)aniline.
| Compound Name | 4-(4-aminophenyl)-2,3,5,6-tetrakis(3-methylphenyl)aniline |
|---|---|
| PubChem CID | 87615494 |
| Molecular Formula | C40H36N2 |
| Molecular Weight | 544.74 g/mol |
| Exact Mass | 544.29 |
| IUPAC Name | 4-(4-aminophenyl)-2,3,5,6-tetrakis(3-methylphenyl)aniline |
| SMILES | Cc1cccc(-c2c(N)c(-c3cccc(C)c3)c(-c3cccc(C)c3)c(-c3ccc(N)cc3)c2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C40H36N2/c1-25-9-5-13-30(21-25)36-35(29-17-19-34(41)20-18-29)37(31-14-6-10-26(2)22-31)39(33-16-8-12-28(4)24-33)40(42)38(36)32-15-7-11-27(3)23-32/h5-24H,41-42H2,1-4H3 |
| InChIKey | LHBRGNNJQSXUCS-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.74 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|