C38H32N2 — CID 22630523
4-(4-aminophenyl)-2,3-bis(3-methylphenyl)-5,6-diphenylaniline (PubChem CID 22630523) has the molecular formula C38H32N2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)-5,6-diphenylaniline.
| Compound Name | 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)-5,6-diphenylaniline |
|---|---|
| PubChem CID | 22630523 |
| Molecular Formula | C38H32N2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 4-(4-aminophenyl)-2,3-bis(3-methylphenyl)-5,6-diphenylaniline |
| SMILES | Cc1cccc(-c2c(N)c(-c3ccccc3)c(-c3ccccc3)c(-c3ccc(N)cc3)c2-c2cccc(C)c2)c1 |
| InChI | InChI=1S/C38H32N2/c1-25-11-9-17-30(23-25)35-33(29-19-21-32(39)22-20-29)34(27-13-5-3-6-14-27)36(28-15-7-4-8-16-28)38(40)37(35)31-18-10-12-26(2)24-31/h3-24H,39-40H2,1-2H3 |
| InChIKey | YTZQCZQEUJBXSQ-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|