C22H48 — CID 144963527
ethane;1,2,3,4,5,6-hexamethylbenzene (PubChem CID 144963527) has the molecular formula C22H48 and a molecular weight of 312.63 g/mol. Its IUPAC name is ethane;1,2,3,4,5,6-hexamethylbenzene.
| Compound Name | ethane;1,2,3,4,5,6-hexamethylbenzene |
|---|---|
| PubChem CID | 144963527 |
| Molecular Formula | C22H48 |
| Molecular Weight | 312.63 g/mol |
| Exact Mass | 312.38 |
| IUPAC Name | ethane;1,2,3,4,5,6-hexamethylbenzene |
| SMILES | CC.CC.CC.CC.CC.Cc1c(C)c(C)c(C)c(C)c1C |
| InChI | InChI=1S/C12H18.5C2H6/c1-7-8(2)10(4)12(6)11(5)9(7)3;5*1-2/h1-6H3;5*1-2H3 |
| InChIKey | WVVPUDWERYQEOY-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.63 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |