C42H54 — CID 145429848
1,2,3,4,5-pentamethyl-6-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)phenyl]phenyl]benzene (PubChem CID 145429848) has the molecular formula C42H54 and a molecular weight of 558.89 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)phenyl]phenyl]benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)phenyl]phenyl]benzene |
|---|---|
| PubChem CID | 145429848 |
| Molecular Formula | C42H54 |
| Molecular Weight | 558.89 g/mol |
| Exact Mass | 558.42 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-(2,3,4,5,6-pentamethylphenyl)phenyl]phenyl]benzene |
| SMILES | Cc1c(C)c(C)c(-c2c(C)c(C)c(-c3c(C)c(C)c(-c4c(C)c(C)c(C)c(C)c4C)c(C)c3C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C42H54/c1-19-21(3)25(7)37(26(8)22(19)4)39-29(11)33(15)41(34(16)30(39)12)42-35(17)31(13)40(32(14)36(42)18)38-27(9)23(5)20(2)24(6)28(38)10/h1-18H3 |
| InChIKey | JHUBHWXNKXDNTR-UHFFFAOYSA-N |
| XLogP | 12.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.89 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |