C50H60 — CID 59816825
1,2,3,4,5,7,8,9,10,12-decamethyl-6,11-bis(2,3,4,5,6-pentamethylphenyl)tetracene (PubChem CID 59816825) has the molecular formula C50H60 and a molecular weight of 661.03 g/mol. Its IUPAC name is 1,2,3,4,5,7,8,9,10,12-decamethyl-6,11-bis(2,3,4,5,6-pentamethylphenyl)tetracene.
| Compound Name | 1,2,3,4,5,7,8,9,10,12-decamethyl-6,11-bis(2,3,4,5,6-pentamethylphenyl)tetracene |
|---|---|
| PubChem CID | 59816825 |
| Molecular Formula | C50H60 |
| Molecular Weight | 661.03 g/mol |
| Exact Mass | 660.47 |
| IUPAC Name | 1,2,3,4,5,7,8,9,10,12-decamethyl-6,11-bis(2,3,4,5,6-pentamethylphenyl)tetracene |
| SMILES | Cc1c(C)c(C)c(-c2c3c(C)c(C)c(C)c(C)c3c(-c3c(C)c(C)c(C)c(C)c3C)c3c(C)c4c(C)c(C)c(C)c(C)c4c(C)c23)c(C)c1C |
| InChI | InChI=1S/C50H60/c1-21-23(3)31(11)41(32(12)24(21)4)49-45-37(17)29(9)30(10)38(18)46(45)50(42-33(13)25(5)22(2)26(6)34(42)14)48-40(20)44-36(16)28(8)27(7)35(15)43(44)39(19)47(48)49/h1-20H3 |
| InChIKey | DVHRSKHJXVSBSZ-UHFFFAOYSA-N |
| XLogP | 14.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.03 |
| LogP ≤ 5 | 14.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|