C12H30B3U — CID 134902011
boranuide;1,2,3,4,5,6-hexamethylbenzene;uranium(3+) (PubChem CID 134902011) has the molecular formula C12H30B3U and a molecular weight of 444.84 g/mol. Its IUPAC name is boranuide;1,2,3,4,5,6-hexamethylbenzene;uranium(3+).
| Compound Name | boranuide;1,2,3,4,5,6-hexamethylbenzene;uranium(3+) |
|---|---|
| PubChem CID | 134902011 |
| Molecular Formula | C12H30B3U |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 445.31 |
| IUPAC Name | boranuide;1,2,3,4,5,6-hexamethylbenzene;uranium(3+) |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.[BH4-].[BH4-].[BH4-].[U+3] |
| InChI | InChI=1S/C12H18.3BH4.U/c1-7-8(2)10(4)12(6)11(5)9(7)3;;;;/h1-6H3;3*1H4;/q;3*-1;+3 |
| InChIKey | VTEYPHOFTVIVEY-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|