C14H18MnO2 — CID 11747742
carbon monoxide;1,2,3,4,5,6-hexamethylbenzene;manganese (PubChem CID 11747742) has the molecular formula C14H18MnO2 and a molecular weight of 273.23 g/mol. Its IUPAC name is carbon monoxide;1,2,3,4,5,6-hexamethylbenzene;manganese.
| Compound Name | carbon monoxide;1,2,3,4,5,6-hexamethylbenzene;manganese |
|---|---|
| PubChem CID | 11747742 |
| Molecular Formula | C14H18MnO2 |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | carbon monoxide;1,2,3,4,5,6-hexamethylbenzene;manganese |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.[C-]#[O+].[C-]#[O+].[Mn] |
| InChI | InChI=1S/C12H18.2CO.Mn/c1-7-8(2)10(4)12(6)11(5)9(7)3;2*1-2;/h1-6H3;;; |
| InChIKey | FNXSZYXYDWPQEK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 39.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|