C46H58 — CID 59927845
1,2,3,4,5-pentamethyl-6-[2-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-[2-(2,3,4,5,6-pentamethylphenyl)ethenyl]phenyl]phenyl]ethenyl]benzene (PubChem CID 59927845) has the molecular formula C46H58 and a molecular weight of 610.97 g/mol. Its IUPAC name is 1,2,3,4,5-pentamethyl-6-[2-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-[2-(2,3,4,5,6-pentamethylphenyl)ethenyl]phenyl]phenyl]ethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentamethyl-6-[2-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-[2-(2,3,4,5,6-pentamethylphenyl)ethenyl]phenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 59927845 |
| Molecular Formula | C46H58 |
| Molecular Weight | 610.97 g/mol |
| Exact Mass | 610.45 |
| IUPAC Name | 1,2,3,4,5-pentamethyl-6-[2-[2,3,5,6-tetramethyl-4-[2,3,5,6-tetramethyl-4-[2-(2,3,4,5,6-pentamethylphenyl)ethenyl]phenyl]phenyl]ethenyl]benzene |
| SMILES | Cc1c(C)c(C)c(C=Cc2c(C)c(C)c(-c3c(C)c(C)c(C=Cc4c(C)c(C)c(C)c(C)c4C)c(C)c3C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C46H58/c1-23-25(3)29(7)41(30(8)26(23)4)19-21-43-33(11)37(15)45(38(16)34(43)12)46-39(17)35(13)44(36(14)40(46)18)22-20-42-31(9)27(5)24(2)28(6)32(42)10/h19-22H,1-18H3 |
| InChIKey | ADZMSCCTYCSEMA-UHFFFAOYSA-N |
| XLogP | 13.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.97 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|