C25H32O — CID 59942137
(E)-1,3-bis(2,3,4,5,6-pentamethylphenyl)prop-2-en-1-one (PubChem CID 59942137) has the molecular formula C25H32O and a molecular weight of 348.53 g/mol. Its IUPAC name is (E)-1,3-bis(2,3,4,5,6-pentamethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1,3-bis(2,3,4,5,6-pentamethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 59942137 |
| Molecular Formula | C25H32O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (E)-1,3-bis(2,3,4,5,6-pentamethylphenyl)prop-2-en-1-one |
| SMILES | Cc1c(C)c(C)c(/C=C/C(=O)c2c(C)c(C)c(C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C25H32O/c1-13-15(3)19(7)23(20(8)16(13)4)11-12-24(26)25-21(9)17(5)14(2)18(6)22(25)10/h11-12H,1-10H3/b12-11+ |
| InChIKey | BJMXRFNMUCNKGL-VAWYXSNFSA-N |
| XLogP | 6.67 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|