About 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid
5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid (PubChem CID 87603827) has the molecular formula C21H19F3O4S
and a molecular weight of 424.44 g/mol. Its IUPAC name is 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid |
| PubChem CID | 87603827 |
| Molecular Formula | C21H19F3O4S |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid |
| SMILES | COc1c(C=CC(=O)c2ccc(SC)cc2)c(C)c(C)c(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C21H19F3O4S/c1-11-12(2)17(20(26)27)18(21(22,23)24)19(28-3)15(11)9-10-16(25)13-5-7-14(29-4)8-6-13/h5-10H,1-4H3,(H,26,27) |
| InChIKey | GLZBCSRQDKSSHS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid?
The IUPAC name of 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid (CID 87603827) is 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid?
The canonical SMILES for 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid is COc1c(C=CC(=O)c2ccc(SC)cc2)c(C)c(C)c(C(=O)O)c1C(F)(F)F.
What is the InChIKey of 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid?
The InChIKey is GLZBCSRQDKSSHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F3O4S/c1-11-12(2)17(20(26)27)18(21(22,23)24)19(28-3)15(11)9-10-16(25)13-5-7-14(29-4)8-6-13/h5-10H,1-4H3,(H,26,27).
What are the key properties of 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid?
5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid has a molecular weight of 424.44 g/mol, XLogP of 5.65, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2,3-dimethyl-4-[3-(4-methylsulfanylphenyl)-3-oxoprop-1-enyl]-6-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 87603827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).