C36H48 — CID 58823326
1,2,4,5-tetramethyl-3-prop-1-enyl-6-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethyl-4-propylphenyl)phenyl]benzene (PubChem CID 58823326) has the molecular formula C36H48 and a molecular weight of 480.78 g/mol. Its IUPAC name is 1,2,4,5-tetramethyl-3-prop-1-enyl-6-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethyl-4-propylphenyl)phenyl]benzene.
| Compound Name | 1,2,4,5-tetramethyl-3-prop-1-enyl-6-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethyl-4-propylphenyl)phenyl]benzene |
|---|---|
| PubChem CID | 58823326 |
| Molecular Formula | C36H48 |
| Molecular Weight | 480.78 g/mol |
| Exact Mass | 480.38 |
| IUPAC Name | 1,2,4,5-tetramethyl-3-prop-1-enyl-6-[2,3,5,6-tetramethyl-4-(2,3,5,6-tetramethyl-4-propylphenyl)phenyl]benzene |
| SMILES | CC=Cc1c(C)c(C)c(-c2c(C)c(C)c(-c3c(C)c(C)c(CCC)c(C)c3C)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C36H48/c1-15-17-31-19(3)23(7)33(24(8)20(31)4)35-27(11)29(13)36(30(14)28(35)12)34-25(9)21(5)32(18-16-2)22(6)26(34)10/h15,17H,16,18H2,1-14H3 |
| InChIKey | RUVUBYUFEPWZNH-UHFFFAOYSA-N |
| XLogP | 10.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.78 |
| LogP ≤ 5 | 10.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |