C23H24 — CID 159474503
1-(2,3,4,5-tetramethyl-6-prop-1-enylphenyl)naphthalene (PubChem CID 159474503) has the molecular formula C23H24 and a molecular weight of 300.45 g/mol. Its IUPAC name is 1-(2,3,4,5-tetramethyl-6-prop-1-enylphenyl)naphthalene.
| Compound Name | 1-(2,3,4,5-tetramethyl-6-prop-1-enylphenyl)naphthalene |
|---|---|
| PubChem CID | 159474503 |
| Molecular Formula | C23H24 |
| Molecular Weight | 300.45 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | 1-(2,3,4,5-tetramethyl-6-prop-1-enylphenyl)naphthalene |
| SMILES | CC=Cc1c(C)c(C)c(C)c(C)c1-c1cccc2ccccc12 |
| InChI | InChI=1S/C23H24/c1-6-10-20-17(4)15(2)16(3)18(5)23(20)22-14-9-12-19-11-7-8-13-21(19)22/h6-14H,1-5H3 |
| InChIKey | BZWJHLPNIICOGO-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.45 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |