C14H24N+ — CID 159545939
1-ethyl-2,3,5,6-tetramethyl-4-propylpyridin-1-ium (PubChem CID 159545939) has the molecular formula C14H24N+ and a molecular weight of 206.35 g/mol. Its IUPAC name is 1-ethyl-2,3,5,6-tetramethyl-4-propylpyridin-1-ium.
| Compound Name | 1-ethyl-2,3,5,6-tetramethyl-4-propylpyridin-1-ium |
|---|---|
| PubChem CID | 159545939 |
| Molecular Formula | C14H24N+ |
| Molecular Weight | 206.35 g/mol |
| Exact Mass | 206.19 |
| IUPAC Name | 1-ethyl-2,3,5,6-tetramethyl-4-propylpyridin-1-ium |
| SMILES | CCCc1c(C)c(C)[n+](CC)c(C)c1C |
| InChI | InChI=1S/C14H24N/c1-7-9-14-10(3)12(5)15(8-2)13(6)11(14)4/h7-9H2,1-6H3/q+1 |
| InChIKey | ADOJACKFQRAWGS-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|